About N-diazobenzenesulfonamide;prop-1-ene;pyran-2-one
N-diazobenzenesulfonamide;prop-1-ene;pyran-2-one (PubChem CID 174921583) has the molecular formula C14H15N3O4S
and a molecular weight of 321.36 g/mol. Its IUPAC name is N-diazobenzenesulfonamide;prop-1-ene;pyran-2-one.
Molecular Properties
| Compound Name | N-diazobenzenesulfonamide;prop-1-ene;pyran-2-one |
| PubChem CID | 174921583 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-diazobenzenesulfonamide;prop-1-ene;pyran-2-one |
| SMILES | C=CC.O=c1cccco1.[N-]=[N+]=NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C6H5N3O2S.C5H4O2.C3H6/c7-8-9-12(10,11)6-4-2-1-3-5-6;6-5-3-1-2-4-7-5;1-3-2/h1-5H;1-4H;3H,1H2,2H3 |
| InChIKey | AATZZTDKCBUJIW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 113.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-diazobenzenesulfonamide;prop-1-ene;pyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-diazobenzenesulfonamide;prop-1-ene;pyran-2-one?
The IUPAC name of N-diazobenzenesulfonamide;prop-1-ene;pyran-2-one (CID 174921583) is N-diazobenzenesulfonamide;prop-1-ene;pyran-2-one.
What is the SMILES notation for N-diazobenzenesulfonamide;prop-1-ene;pyran-2-one?
The canonical SMILES for N-diazobenzenesulfonamide;prop-1-ene;pyran-2-one is C=CC.O=c1cccco1.[N-]=[N+]=NS(=O)(=O)c1ccccc1.
What is the InChIKey of N-diazobenzenesulfonamide;prop-1-ene;pyran-2-one?
The InChIKey is AATZZTDKCBUJIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O2S.C5H4O2.C3H6/c7-8-9-12(10,11)6-4-2-1-3-5-6;6-5-3-1-2-4-7-5;1-3-2/h1-5H;1-4H;3H,1H2,2H3.
What are the key properties of N-diazobenzenesulfonamide;prop-1-ene;pyran-2-one?
N-diazobenzenesulfonamide;prop-1-ene;pyran-2-one has a molecular weight of 321.36 g/mol, XLogP of 3.52, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-diazobenzenesulfonamide;prop-1-ene;pyran-2-one is sourced from PubChem (CID 174921583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).