C8H16N2O5 — CID 174921699
3,4,5-trihydroxy-2,2-dimethylhexanediamide (PubChem CID 174921699) has the molecular formula C8H16N2O5 and a molecular weight of 220.23 g/mol. Its IUPAC name is 3,4,5-trihydroxy-2,2-dimethylhexanediamide.
| Compound Name | 3,4,5-trihydroxy-2,2-dimethylhexanediamide |
|---|---|
| PubChem CID | 174921699 |
| Molecular Formula | C8H16N2O5 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 3,4,5-trihydroxy-2,2-dimethylhexanediamide |
| SMILES | CC(C)(C(N)=O)C(O)C(O)C(O)C(N)=O |
| InChI | InChI=1S/C8H16N2O5/c1-8(2,7(10)15)5(13)3(11)4(12)6(9)14/h3-5,11-13H,1-2H3,(H2,9,14)(H2,10,15) |
| InChIKey | ZYNJHMXDPGAHGY-UHFFFAOYSA-N |
| XLogP | -2.93 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |