C24H52O4 — CID 174921786
1,6-bis(2-methylpentan-2-ylperoxy)hexane;hexane (PubChem CID 174921786) has the molecular formula C24H52O4 and a molecular weight of 404.68 g/mol. Its IUPAC name is 1,6-bis(2-methylpentan-2-ylperoxy)hexane;hexane.
| Compound Name | 1,6-bis(2-methylpentan-2-ylperoxy)hexane;hexane |
|---|---|
| PubChem CID | 174921786 |
| Molecular Formula | C24H52O4 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 404.39 |
| IUPAC Name | 1,6-bis(2-methylpentan-2-ylperoxy)hexane;hexane |
| SMILES | CCCC(C)(C)OOCCCCCCOOC(C)(C)CCC.CCCCCC |
| InChI | InChI=1S/C18H38O4.C6H14/c1-7-13-17(3,4)21-19-15-11-9-10-12-16-20-22-18(5,6)14-8-2;1-3-5-6-4-2/h7-16H2,1-6H3;3-6H2,1-2H3 |
| InChIKey | KVSKFRCCHOZHTH-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|