About 4-amino-5-ethyl-1,2,4-triazole-3-carbothialdehyde
4-amino-5-ethyl-1,2,4-triazole-3-carbothialdehyde (PubChem CID 174921907) has the molecular formula C5H8N4S
and a molecular weight of 156.21 g/mol. Its IUPAC name is 4-amino-5-ethyl-1,2,4-triazole-3-carbothialdehyde.
Molecular Properties
| Compound Name | 4-amino-5-ethyl-1,2,4-triazole-3-carbothialdehyde |
| PubChem CID | 174921907 |
| Molecular Formula | C5H8N4S |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 4-amino-5-ethyl-1,2,4-triazole-3-carbothialdehyde |
| SMILES | CCc1nnc(C=S)n1N |
| InChI | InChI=1S/C5H8N4S/c1-2-4-7-8-5(3-10)9(4)6/h3H,2,6H2,1H3 |
| InChIKey | AHLCRTKBAIEXTB-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-5-ethyl-1,2,4-triazole-3-carbothialdehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-ethyl-1,2,4-triazole-3-carbothialdehyde?
The IUPAC name of 4-amino-5-ethyl-1,2,4-triazole-3-carbothialdehyde (CID 174921907) is 4-amino-5-ethyl-1,2,4-triazole-3-carbothialdehyde.
What is the SMILES notation for 4-amino-5-ethyl-1,2,4-triazole-3-carbothialdehyde?
The canonical SMILES for 4-amino-5-ethyl-1,2,4-triazole-3-carbothialdehyde is CCc1nnc(C=S)n1N.
What is the InChIKey of 4-amino-5-ethyl-1,2,4-triazole-3-carbothialdehyde?
The InChIKey is AHLCRTKBAIEXTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4S/c1-2-4-7-8-5(3-10)9(4)6/h3H,2,6H2,1H3.
What are the key properties of 4-amino-5-ethyl-1,2,4-triazole-3-carbothialdehyde?
4-amino-5-ethyl-1,2,4-triazole-3-carbothialdehyde has a molecular weight of 156.21 g/mol, XLogP of -0.10, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-ethyl-1,2,4-triazole-3-carbothialdehyde is sourced from PubChem (CID 174921907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).