C10H22N2 — CID 174921978
4-cyclohexylbutane-1,1-diamine (PubChem CID 174921978) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 4-cyclohexylbutane-1,1-diamine.
| Compound Name | 4-cyclohexylbutane-1,1-diamine |
|---|---|
| PubChem CID | 174921978 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 4-cyclohexylbutane-1,1-diamine |
| SMILES | NC(N)CCCC1CCCCC1 |
| InChI | InChI=1S/C10H22N2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h9-10H,1-8,11-12H2 |
| InChIKey | VXXHEDYXDSXBIH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|