About 2,6-dimethylmorpholine;thiophene
2,6-dimethylmorpholine;thiophene (PubChem CID 174922010) has the molecular formula C10H17NOS
and a molecular weight of 199.32 g/mol. Its IUPAC name is 2,6-dimethylmorpholine;thiophene.
Molecular Properties
| Compound Name | 2,6-dimethylmorpholine;thiophene |
| PubChem CID | 174922010 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 2,6-dimethylmorpholine;thiophene |
| SMILES | CC1CNCC(C)O1.c1ccsc1 |
| InChI | InChI=1S/C6H13NO.C4H4S/c1-5-3-7-4-6(2)8-5;1-2-4-5-3-1/h5-7H,3-4H2,1-2H3;1-4H |
| InChIKey | XWBIDDHERWYLGH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-dimethylmorpholine;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylmorpholine;thiophene?
The IUPAC name of 2,6-dimethylmorpholine;thiophene (CID 174922010) is 2,6-dimethylmorpholine;thiophene.
What is the SMILES notation for 2,6-dimethylmorpholine;thiophene?
The canonical SMILES for 2,6-dimethylmorpholine;thiophene is CC1CNCC(C)O1.c1ccsc1.
What is the InChIKey of 2,6-dimethylmorpholine;thiophene?
The InChIKey is XWBIDDHERWYLGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.C4H4S/c1-5-3-7-4-6(2)8-5;1-2-4-5-3-1/h5-7H,3-4H2,1-2H3;1-4H.
What are the key properties of 2,6-dimethylmorpholine;thiophene?
2,6-dimethylmorpholine;thiophene has a molecular weight of 199.32 g/mol, XLogP of 2.13, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylmorpholine;thiophene is sourced from PubChem (CID 174922010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).