About cyclohexyl 2-methylprop-2-enoate;2-methylprop-1-ene
cyclohexyl 2-methylprop-2-enoate;2-methylprop-1-ene (PubChem CID 174922373) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is cyclohexyl 2-methylprop-2-enoate;2-methylprop-1-ene.
Molecular Properties
| Compound Name | cyclohexyl 2-methylprop-2-enoate;2-methylprop-1-ene |
| PubChem CID | 174922373 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | cyclohexyl 2-methylprop-2-enoate;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=C(C)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C10H16O2.C4H8/c1-8(2)10(11)12-9-6-4-3-5-7-9;1-4(2)3/h9H,1,3-7H2,2H3;1H2,2-3H3 |
| InChIKey | JBYJBGCLICYMMM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl 2-methylprop-2-enoate;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 2-methylprop-2-enoate;2-methylprop-1-ene?
The IUPAC name of cyclohexyl 2-methylprop-2-enoate;2-methylprop-1-ene (CID 174922373) is cyclohexyl 2-methylprop-2-enoate;2-methylprop-1-ene.
What is the SMILES notation for cyclohexyl 2-methylprop-2-enoate;2-methylprop-1-ene?
The canonical SMILES for cyclohexyl 2-methylprop-2-enoate;2-methylprop-1-ene is C=C(C)C.C=C(C)C(=O)OC1CCCCC1.
What is the InChIKey of cyclohexyl 2-methylprop-2-enoate;2-methylprop-1-ene?
The InChIKey is JBYJBGCLICYMMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2.C4H8/c1-8(2)10(11)12-9-6-4-3-5-7-9;1-4(2)3/h9H,1,3-7H2,2H3;1H2,2-3H3.
What are the key properties of cyclohexyl 2-methylprop-2-enoate;2-methylprop-1-ene?
cyclohexyl 2-methylprop-2-enoate;2-methylprop-1-ene has a molecular weight of 224.34 g/mol, XLogP of 4.02, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 2-methylprop-2-enoate;2-methylprop-1-ene is sourced from PubChem (CID 174922373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).