C22H36O2 — CID 174922524
non-1-ene;2,6,6,10-tetramethyl-1-oxaspiro[4.5]deca-2,9-dien-8-one (PubChem CID 174922524) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is non-1-ene;2,6,6,10-tetramethyl-1-oxaspiro[4.5]deca-2,9-dien-8-one.
| Compound Name | non-1-ene;2,6,6,10-tetramethyl-1-oxaspiro[4.5]deca-2,9-dien-8-one |
|---|---|
| PubChem CID | 174922524 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | non-1-ene;2,6,6,10-tetramethyl-1-oxaspiro[4.5]deca-2,9-dien-8-one |
| SMILES | C=CCCCCCCC.CC1=CCC2(O1)C(C)=CC(=O)CC2(C)C |
| InChI | InChI=1S/C13H18O2.C9H18/c1-9-7-11(14)8-12(3,4)13(9)6-5-10(2)15-13;1-3-5-7-9-8-6-4-2/h5,7H,6,8H2,1-4H3;3H,1,4-9H2,2H3 |
| InChIKey | YXOUTRHUCBWYNN-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|