About 6-carbamoylnaphthalene-2-carboxylic acid;1H-phenalene
6-carbamoylnaphthalene-2-carboxylic acid;1H-phenalene (PubChem CID 174922794) has the molecular formula C25H19NO3
and a molecular weight of 381.43 g/mol. Its IUPAC name is 6-carbamoylnaphthalene-2-carboxylic acid;1H-phenalene.
Molecular Properties
| Compound Name | 6-carbamoylnaphthalene-2-carboxylic acid;1H-phenalene |
| PubChem CID | 174922794 |
| Molecular Formula | C25H19NO3 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 6-carbamoylnaphthalene-2-carboxylic acid;1H-phenalene |
| SMILES | C1=Cc2cccc3cccc(c23)C1.NC(=O)c1ccc2cc(C(=O)O)ccc2c1 |
| InChI | InChI=1S/C13H10.C12H9NO3/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;13-11(14)9-3-1-8-6-10(12(15)16)4-2-7(8)5-9/h1-8H,9H2;1-6H,(H2,13,14)(H,15,16) |
| InChIKey | MDSGDBTVQKFQAJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-carbamoylnaphthalene-2-carboxylic acid;1H-phenalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-carbamoylnaphthalene-2-carboxylic acid;1H-phenalene?
The IUPAC name of 6-carbamoylnaphthalene-2-carboxylic acid;1H-phenalene (CID 174922794) is 6-carbamoylnaphthalene-2-carboxylic acid;1H-phenalene.
What is the SMILES notation for 6-carbamoylnaphthalene-2-carboxylic acid;1H-phenalene?
The canonical SMILES for 6-carbamoylnaphthalene-2-carboxylic acid;1H-phenalene is C1=Cc2cccc3cccc(c23)C1.NC(=O)c1ccc2cc(C(=O)O)ccc2c1.
What is the InChIKey of 6-carbamoylnaphthalene-2-carboxylic acid;1H-phenalene?
The InChIKey is MDSGDBTVQKFQAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.C12H9NO3/c1-4-10-6-2-8-12-9-3-7-11(5-1)13(10)12;13-11(14)9-3-1-8-6-10(12(15)16)4-2-7(8)5-9/h1-8H,9H2;1-6H,(H2,13,14)(H,15,16).
What are the key properties of 6-carbamoylnaphthalene-2-carboxylic acid;1H-phenalene?
6-carbamoylnaphthalene-2-carboxylic acid;1H-phenalene has a molecular weight of 381.43 g/mol, XLogP of 5.05, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-carbamoylnaphthalene-2-carboxylic acid;1H-phenalene is sourced from PubChem (CID 174922794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).