About 2-azabicyclo[3.3.1]nona-1(8),5(9),6-triene;4-methylpiperidine
2-azabicyclo[3.3.1]nona-1(8),5(9),6-triene;4-methylpiperidine (PubChem CID 174923461) has the molecular formula C14H22N2
and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-azabicyclo[3.3.1]nona-1(8),5(9),6-triene;4-methylpiperidine.
Molecular Properties
| Compound Name | 2-azabicyclo[3.3.1]nona-1(8),5(9),6-triene;4-methylpiperidine |
| PubChem CID | 174923461 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 2-azabicyclo[3.3.1]nona-1(8),5(9),6-triene;4-methylpiperidine |
| SMILES | CC1CCNCC1.c1cc2cc(c1)NCC2 |
| InChI | InChI=1S/C8H9N.C6H13N/c1-2-7-4-5-9-8(3-1)6-7;1-6-2-4-7-5-3-6/h1-3,6,9H,4-5H2;6-7H,2-5H2,1H3 |
| InChIKey | ZSEDXJCUODSOCA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-azabicyclo[3.3.1]nona-1(8),5(9),6-triene;4-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azabicyclo[3.3.1]nona-1(8),5(9),6-triene;4-methylpiperidine?
The IUPAC name of 2-azabicyclo[3.3.1]nona-1(8),5(9),6-triene;4-methylpiperidine (CID 174923461) is 2-azabicyclo[3.3.1]nona-1(8),5(9),6-triene;4-methylpiperidine.
What is the SMILES notation for 2-azabicyclo[3.3.1]nona-1(8),5(9),6-triene;4-methylpiperidine?
The canonical SMILES for 2-azabicyclo[3.3.1]nona-1(8),5(9),6-triene;4-methylpiperidine is CC1CCNCC1.c1cc2cc(c1)NCC2.
What is the InChIKey of 2-azabicyclo[3.3.1]nona-1(8),5(9),6-triene;4-methylpiperidine?
The InChIKey is ZSEDXJCUODSOCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N.C6H13N/c1-2-7-4-5-9-8(3-1)6-7;1-6-2-4-7-5-3-6/h1-3,6,9H,4-5H2;6-7H,2-5H2,1H3.
What are the key properties of 2-azabicyclo[3.3.1]nona-1(8),5(9),6-triene;4-methylpiperidine?
2-azabicyclo[3.3.1]nona-1(8),5(9),6-triene;4-methylpiperidine has a molecular weight of 218.34 g/mol, XLogP of 2.66, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azabicyclo[3.3.1]nona-1(8),5(9),6-triene;4-methylpiperidine is sourced from PubChem (CID 174923461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).