C15H10Br2N2 — CID 174923540
1,3-bis(4-bromophenyl)pyrazole (PubChem CID 174923540) has the molecular formula C15H10Br2N2 and a molecular weight of 378.07 g/mol. Its IUPAC name is 1,3-bis(4-bromophenyl)pyrazole.
| Compound Name | 1,3-bis(4-bromophenyl)pyrazole |
|---|---|
| PubChem CID | 174923540 |
| Molecular Formula | C15H10Br2N2 |
| Molecular Weight | 378.07 g/mol |
| Exact Mass | 375.92 |
| IUPAC Name | 1,3-bis(4-bromophenyl)pyrazole |
| SMILES | Brc1ccc(-c2ccn(-c3ccc(Br)cc3)n2)cc1 |
| InChI | InChI=1S/C15H10Br2N2/c16-12-3-1-11(2-4-12)15-9-10-19(18-15)14-7-5-13(17)6-8-14/h1-10H |
| InChIKey | VSGLBOINSARLTQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.07 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |