About 5-(1H-pyrazol-5-yl)-1,3,4-oxadiazole-2-carbothialdehyde
5-(1H-pyrazol-5-yl)-1,3,4-oxadiazole-2-carbothialdehyde (PubChem CID 174923688) has the molecular formula C6H4N4OS
and a molecular weight of 180.19 g/mol. Its IUPAC name is 5-(1H-pyrazol-5-yl)-1,3,4-oxadiazole-2-carbothialdehyde.
Molecular Properties
| Compound Name | 5-(1H-pyrazol-5-yl)-1,3,4-oxadiazole-2-carbothialdehyde |
| PubChem CID | 174923688 |
| Molecular Formula | C6H4N4OS |
| Molecular Weight | 180.19 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | 5-(1H-pyrazol-5-yl)-1,3,4-oxadiazole-2-carbothialdehyde |
| SMILES | S=Cc1nnc(-c2ccn[nH]2)o1 |
| InChI | InChI=1S/C6H4N4OS/c12-3-5-9-10-6(11-5)4-1-2-7-8-4/h1-3H,(H,7,8) |
| InChIKey | MWBAPDWVJZXESE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(1H-pyrazol-5-yl)-1,3,4-oxadiazole-2-carbothialdehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1H-pyrazol-5-yl)-1,3,4-oxadiazole-2-carbothialdehyde?
The IUPAC name of 5-(1H-pyrazol-5-yl)-1,3,4-oxadiazole-2-carbothialdehyde (CID 174923688) is 5-(1H-pyrazol-5-yl)-1,3,4-oxadiazole-2-carbothialdehyde.
What is the SMILES notation for 5-(1H-pyrazol-5-yl)-1,3,4-oxadiazole-2-carbothialdehyde?
The canonical SMILES for 5-(1H-pyrazol-5-yl)-1,3,4-oxadiazole-2-carbothialdehyde is S=Cc1nnc(-c2ccn[nH]2)o1.
What is the InChIKey of 5-(1H-pyrazol-5-yl)-1,3,4-oxadiazole-2-carbothialdehyde?
The InChIKey is MWBAPDWVJZXESE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4OS/c12-3-5-9-10-6(11-5)4-1-2-7-8-4/h1-3H,(H,7,8).
What are the key properties of 5-(1H-pyrazol-5-yl)-1,3,4-oxadiazole-2-carbothialdehyde?
5-(1H-pyrazol-5-yl)-1,3,4-oxadiazole-2-carbothialdehyde has a molecular weight of 180.19 g/mol, XLogP of 0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1H-pyrazol-5-yl)-1,3,4-oxadiazole-2-carbothialdehyde is sourced from PubChem (CID 174923688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).