About dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;methanol
dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;methanol (PubChem CID 174924399) has the molecular formula C7H16N2OS4
and a molecular weight of 272.49 g/mol. Its IUPAC name is dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;methanol.
Molecular Properties
| Compound Name | dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;methanol |
| PubChem CID | 174924399 |
| Molecular Formula | C7H16N2OS4 |
| Molecular Weight | 272.49 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;methanol |
| SMILES | CN(C)C(=S)SSC(=S)N(C)C.CO |
| InChI | InChI=1S/C6H12N2S4.CH4O/c1-7(2)5(9)11-12-6(10)8(3)4;1-2/h1-4H3;2H,1H3 |
| InChIKey | PLTFWYSYJWUBKU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;methanol?
The IUPAC name of dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;methanol (CID 174924399) is dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;methanol.
What is the SMILES notation for dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;methanol?
The canonical SMILES for dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;methanol is CN(C)C(=S)SSC(=S)N(C)C.CO.
What is the InChIKey of dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;methanol?
The InChIKey is PLTFWYSYJWUBKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2S4.CH4O/c1-7(2)5(9)11-12-6(10)8(3)4;1-2/h1-4H3;2H,1H3.
What are the key properties of dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;methanol?
dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;methanol has a molecular weight of 272.49 g/mol, XLogP of 1.67, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;methanol is sourced from PubChem (CID 174924399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).