About 5-(2-methyl-1,4-dioxan-2-yl)pentane-1,4-diamine
5-(2-methyl-1,4-dioxan-2-yl)pentane-1,4-diamine (PubChem CID 174925244) has the molecular formula C10H22N2O2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 5-(2-methyl-1,4-dioxan-2-yl)pentane-1,4-diamine.
Molecular Properties
| Compound Name | 5-(2-methyl-1,4-dioxan-2-yl)pentane-1,4-diamine |
| PubChem CID | 174925244 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 5-(2-methyl-1,4-dioxan-2-yl)pentane-1,4-diamine |
| SMILES | CC1(CC(N)CCCN)COCCO1 |
| InChI | InChI=1S/C10H22N2O2/c1-10(8-13-5-6-14-10)7-9(12)3-2-4-11/h9H,2-8,11-12H2,1H3 |
| InChIKey | FPUWUKVQGSMKFN-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-methyl-1,4-dioxan-2-yl)pentane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methyl-1,4-dioxan-2-yl)pentane-1,4-diamine?
The IUPAC name of 5-(2-methyl-1,4-dioxan-2-yl)pentane-1,4-diamine (CID 174925244) is 5-(2-methyl-1,4-dioxan-2-yl)pentane-1,4-diamine.
What is the SMILES notation for 5-(2-methyl-1,4-dioxan-2-yl)pentane-1,4-diamine?
The canonical SMILES for 5-(2-methyl-1,4-dioxan-2-yl)pentane-1,4-diamine is CC1(CC(N)CCCN)COCCO1.
What is the InChIKey of 5-(2-methyl-1,4-dioxan-2-yl)pentane-1,4-diamine?
The InChIKey is FPUWUKVQGSMKFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O2/c1-10(8-13-5-6-14-10)7-9(12)3-2-4-11/h9H,2-8,11-12H2,1H3.
What are the key properties of 5-(2-methyl-1,4-dioxan-2-yl)pentane-1,4-diamine?
5-(2-methyl-1,4-dioxan-2-yl)pentane-1,4-diamine has a molecular weight of 202.30 g/mol, XLogP of 0.25, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methyl-1,4-dioxan-2-yl)pentane-1,4-diamine is sourced from PubChem (CID 174925244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).