About [1-chloro-2-(1,3,4-thiadiazol-2-yl)ethyl] formate
[1-chloro-2-(1,3,4-thiadiazol-2-yl)ethyl] formate (PubChem CID 174926101) has the molecular formula C5H5ClN2O2S
and a molecular weight of 192.63 g/mol. Its IUPAC name is [1-chloro-2-(1,3,4-thiadiazol-2-yl)ethyl] formate.
Molecular Properties
| Compound Name | [1-chloro-2-(1,3,4-thiadiazol-2-yl)ethyl] formate |
| PubChem CID | 174926101 |
| Molecular Formula | C5H5ClN2O2S |
| Molecular Weight | 192.63 g/mol |
| Exact Mass | 191.98 |
| IUPAC Name | [1-chloro-2-(1,3,4-thiadiazol-2-yl)ethyl] formate |
| SMILES | O=COC(Cl)Cc1nncs1 |
| InChI | InChI=1S/C5H5ClN2O2S/c6-4(10-3-9)1-5-8-7-2-11-5/h2-4H,1H2 |
| InChIKey | VQKCQFJOHIBOTC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.63 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [1-chloro-2-(1,3,4-thiadiazol-2-yl)ethyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-chloro-2-(1,3,4-thiadiazol-2-yl)ethyl] formate?
The IUPAC name of [1-chloro-2-(1,3,4-thiadiazol-2-yl)ethyl] formate (CID 174926101) is [1-chloro-2-(1,3,4-thiadiazol-2-yl)ethyl] formate.
What is the SMILES notation for [1-chloro-2-(1,3,4-thiadiazol-2-yl)ethyl] formate?
The canonical SMILES for [1-chloro-2-(1,3,4-thiadiazol-2-yl)ethyl] formate is O=COC(Cl)Cc1nncs1.
What is the InChIKey of [1-chloro-2-(1,3,4-thiadiazol-2-yl)ethyl] formate?
The InChIKey is VQKCQFJOHIBOTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClN2O2S/c6-4(10-3-9)1-5-8-7-2-11-5/h2-4H,1H2.
What are the key properties of [1-chloro-2-(1,3,4-thiadiazol-2-yl)ethyl] formate?
[1-chloro-2-(1,3,4-thiadiazol-2-yl)ethyl] formate has a molecular weight of 192.63 g/mol, XLogP of 0.82, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-chloro-2-(1,3,4-thiadiazol-2-yl)ethyl] formate is sourced from PubChem (CID 174926101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).