C8H5F9O2 — CID 174926285
methyl 4,4,5,6,6,6-hexafluoro-5-(trifluoromethyl)hex-2-enoate (PubChem CID 174926285) has the molecular formula C8H5F9O2 and a molecular weight of 304.11 g/mol. Its IUPAC name is methyl 4,4,5,6,6,6-hexafluoro-5-(trifluoromethyl)hex-2-enoate.
| Compound Name | methyl 4,4,5,6,6,6-hexafluoro-5-(trifluoromethyl)hex-2-enoate |
|---|---|
| PubChem CID | 174926285 |
| Molecular Formula | C8H5F9O2 |
| Molecular Weight | 304.11 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | methyl 4,4,5,6,6,6-hexafluoro-5-(trifluoromethyl)hex-2-enoate |
| SMILES | COC(=O)C=CC(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H5F9O2/c1-19-4(18)2-3-5(9,10)6(11,7(12,13)14)8(15,16)17/h2-3H,1H3 |
| InChIKey | ZRSMQUYKVRQBRV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.11 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|