About bis(chloromethyl) carbonate;propan-2-ol
bis(chloromethyl) carbonate;propan-2-ol (PubChem CID 174926864) has the molecular formula C6H12Cl2O4
and a molecular weight of 219.06 g/mol. Its IUPAC name is bis(chloromethyl) carbonate;propan-2-ol.
Molecular Properties
| Compound Name | bis(chloromethyl) carbonate;propan-2-ol |
| PubChem CID | 174926864 |
| Molecular Formula | C6H12Cl2O4 |
| Molecular Weight | 219.06 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | bis(chloromethyl) carbonate;propan-2-ol |
| SMILES | CC(C)O.O=C(OCCl)OCCl |
| InChI | InChI=1S/C3H4Cl2O3.C3H8O/c4-1-7-3(6)8-2-5;1-3(2)4/h1-2H2;3-4H,1-2H3 |
| InChIKey | BUHDJESOTVDWTC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.06 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bis(chloromethyl) carbonate;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(chloromethyl) carbonate;propan-2-ol?
The IUPAC name of bis(chloromethyl) carbonate;propan-2-ol (CID 174926864) is bis(chloromethyl) carbonate;propan-2-ol.
What is the SMILES notation for bis(chloromethyl) carbonate;propan-2-ol?
The canonical SMILES for bis(chloromethyl) carbonate;propan-2-ol is CC(C)O.O=C(OCCl)OCCl.
What is the InChIKey of bis(chloromethyl) carbonate;propan-2-ol?
The InChIKey is BUHDJESOTVDWTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4Cl2O3.C3H8O/c4-1-7-3(6)8-2-5;1-3(2)4/h1-2H2;3-4H,1-2H3.
What are the key properties of bis(chloromethyl) carbonate;propan-2-ol?
bis(chloromethyl) carbonate;propan-2-ol has a molecular weight of 219.06 g/mol, XLogP of 1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(chloromethyl) carbonate;propan-2-ol is sourced from PubChem (CID 174926864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).