About decane;trichlorosilane;hydrofluoride
decane;trichlorosilane;hydrofluoride (PubChem CID 174927652) has the molecular formula C10H24Cl3FSi
and a molecular weight of 297.75 g/mol. Its IUPAC name is decane;trichlorosilane;hydrofluoride.
Molecular Properties
| Compound Name | decane;trichlorosilane;hydrofluoride |
| PubChem CID | 174927652 |
| Molecular Formula | C10H24Cl3FSi |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | decane;trichlorosilane;hydrofluoride |
| SMILES | CCCCCCCCCC.Cl[SiH](Cl)Cl.F |
| InChI | InChI=1S/C10H22.Cl3HSi.FH/c1-3-5-7-9-10-8-6-4-2;1-4(2)3;/h3-10H2,1-2H3;4H;1H |
| InChIKey | KAQZZAMTPNBDJT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze decane;trichlorosilane;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decane;trichlorosilane;hydrofluoride?
The IUPAC name of decane;trichlorosilane;hydrofluoride (CID 174927652) is decane;trichlorosilane;hydrofluoride.
What is the SMILES notation for decane;trichlorosilane;hydrofluoride?
The canonical SMILES for decane;trichlorosilane;hydrofluoride is CCCCCCCCCC.Cl[SiH](Cl)Cl.F.
What is the InChIKey of decane;trichlorosilane;hydrofluoride?
The InChIKey is KAQZZAMTPNBDJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22.Cl3HSi.FH/c1-3-5-7-9-10-8-6-4-2;1-4(2)3;/h3-10H2,1-2H3;4H;1H.
What are the key properties of decane;trichlorosilane;hydrofluoride?
decane;trichlorosilane;hydrofluoride has a molecular weight of 297.75 g/mol, XLogP of 5.72, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for decane;trichlorosilane;hydrofluoride is sourced from PubChem (CID 174927652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).