C20H25BN2O2 — CID 174927770
CID 174927770 (PubChem CID 174927770) has the molecular formula C20H25BN2O2 and a molecular weight of 336.24 g/mol.
| Compound Name | CID 174927770 |
|---|---|
| PubChem CID | 174927770 |
| Molecular Formula | C20H25BN2O2 |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | — |
| SMILES | [B]C(CCCC)(C(=O)O)C1CC(NCc2cccc3cccnc23)C1 |
| InChI | InChI=1S/C20H25BN2O2/c1-2-3-9-20(21,19(24)25)16-11-17(12-16)23-13-15-7-4-6-14-8-5-10-22-18(14)15/h4-8,10,16-17,23H,2-3,9,11-13H2,1H3,(H,24,25) |
| InChIKey | POBGMIHSZRPXML-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|