About chloroform;5-propyl-1,3,4-thiadiazol-2-amine
chloroform;5-propyl-1,3,4-thiadiazol-2-amine (PubChem CID 174928082) has the molecular formula C6H10Cl3N3S
and a molecular weight of 262.59 g/mol. Its IUPAC name is chloroform;5-propyl-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | chloroform;5-propyl-1,3,4-thiadiazol-2-amine |
| PubChem CID | 174928082 |
| Molecular Formula | C6H10Cl3N3S |
| Molecular Weight | 262.59 g/mol |
| Exact Mass | 260.97 |
| IUPAC Name | chloroform;5-propyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCCc1nnc(N)s1.ClC(Cl)Cl |
| InChI | InChI=1S/C5H9N3S.CHCl3/c1-2-3-4-7-8-5(6)9-4;2-1(3)4/h2-3H2,1H3,(H2,6,8);1H |
| InChIKey | OBBVWARVJAKZQE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.59 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloroform;5-propyl-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform;5-propyl-1,3,4-thiadiazol-2-amine?
The IUPAC name of chloroform;5-propyl-1,3,4-thiadiazol-2-amine (CID 174928082) is chloroform;5-propyl-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for chloroform;5-propyl-1,3,4-thiadiazol-2-amine?
The canonical SMILES for chloroform;5-propyl-1,3,4-thiadiazol-2-amine is CCCc1nnc(N)s1.ClC(Cl)Cl.
What is the InChIKey of chloroform;5-propyl-1,3,4-thiadiazol-2-amine?
The InChIKey is OBBVWARVJAKZQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3S.CHCl3/c1-2-3-4-7-8-5(6)9-4;2-1(3)4/h2-3H2,1H3,(H2,6,8);1H.
What are the key properties of chloroform;5-propyl-1,3,4-thiadiazol-2-amine?
chloroform;5-propyl-1,3,4-thiadiazol-2-amine has a molecular weight of 262.59 g/mol, XLogP of 3.06, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform;5-propyl-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 174928082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).