About 3-chloro-3-(2,4,5-trifluorophenyl)propanenitrile
3-chloro-3-(2,4,5-trifluorophenyl)propanenitrile (PubChem CID 174928493) has the molecular formula C9H5ClF3N
and a molecular weight of 219.59 g/mol. Its IUPAC name is 3-chloro-3-(2,4,5-trifluorophenyl)propanenitrile.
Molecular Properties
| Compound Name | 3-chloro-3-(2,4,5-trifluorophenyl)propanenitrile |
| PubChem CID | 174928493 |
| Molecular Formula | C9H5ClF3N |
| Molecular Weight | 219.59 g/mol |
| Exact Mass | 219.01 |
| IUPAC Name | 3-chloro-3-(2,4,5-trifluorophenyl)propanenitrile |
| SMILES | N#CCC(Cl)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C9H5ClF3N/c10-6(1-2-14)5-3-8(12)9(13)4-7(5)11/h3-4,6H,1H2 |
| InChIKey | RNSVJHCZVPQRFJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-3-(2,4,5-trifluorophenyl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-3-(2,4,5-trifluorophenyl)propanenitrile?
The IUPAC name of 3-chloro-3-(2,4,5-trifluorophenyl)propanenitrile (CID 174928493) is 3-chloro-3-(2,4,5-trifluorophenyl)propanenitrile.
What is the SMILES notation for 3-chloro-3-(2,4,5-trifluorophenyl)propanenitrile?
The canonical SMILES for 3-chloro-3-(2,4,5-trifluorophenyl)propanenitrile is N#CCC(Cl)c1cc(F)c(F)cc1F.
What is the InChIKey of 3-chloro-3-(2,4,5-trifluorophenyl)propanenitrile?
The InChIKey is RNSVJHCZVPQRFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClF3N/c10-6(1-2-14)5-3-8(12)9(13)4-7(5)11/h3-4,6H,1H2.
What are the key properties of 3-chloro-3-(2,4,5-trifluorophenyl)propanenitrile?
3-chloro-3-(2,4,5-trifluorophenyl)propanenitrile has a molecular weight of 219.59 g/mol, XLogP of 3.30, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-3-(2,4,5-trifluorophenyl)propanenitrile is sourced from PubChem (CID 174928493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).