About ethanesulfonamide;4-methylpyridazin-3-amine
ethanesulfonamide;4-methylpyridazin-3-amine (PubChem CID 174929350) has the molecular formula C7H14N4O2S
and a molecular weight of 218.28 g/mol. Its IUPAC name is ethanesulfonamide;4-methylpyridazin-3-amine.
Molecular Properties
| Compound Name | ethanesulfonamide;4-methylpyridazin-3-amine |
| PubChem CID | 174929350 |
| Molecular Formula | C7H14N4O2S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | ethanesulfonamide;4-methylpyridazin-3-amine |
| SMILES | CCS(N)(=O)=O.Cc1ccnnc1N |
| InChI | InChI=1S/C5H7N3.C2H7NO2S/c1-4-2-3-7-8-5(4)6;1-2-6(3,4)5/h2-3H,1H3,(H2,6,8);2H2,1H3,(H2,3,4,5) |
| InChIKey | AAPUHFCZDHHPAN-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethanesulfonamide;4-methylpyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanesulfonamide;4-methylpyridazin-3-amine?
The IUPAC name of ethanesulfonamide;4-methylpyridazin-3-amine (CID 174929350) is ethanesulfonamide;4-methylpyridazin-3-amine.
What is the SMILES notation for ethanesulfonamide;4-methylpyridazin-3-amine?
The canonical SMILES for ethanesulfonamide;4-methylpyridazin-3-amine is CCS(N)(=O)=O.Cc1ccnnc1N.
What is the InChIKey of ethanesulfonamide;4-methylpyridazin-3-amine?
The InChIKey is AAPUHFCZDHHPAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3.C2H7NO2S/c1-4-2-3-7-8-5(4)6;1-2-6(3,4)5/h2-3H,1H3,(H2,6,8);2H2,1H3,(H2,3,4,5).
What are the key properties of ethanesulfonamide;4-methylpyridazin-3-amine?
ethanesulfonamide;4-methylpyridazin-3-amine has a molecular weight of 218.28 g/mol, XLogP of -0.34, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethanesulfonamide;4-methylpyridazin-3-amine is sourced from PubChem (CID 174929350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).