C14H23N3S — CID 174929488
azane;1-(4-benzylsulfanylbutyl)-4,5-dihydroimidazole (PubChem CID 174929488) has the molecular formula C14H23N3S and a molecular weight of 265.43 g/mol. Its IUPAC name is azane;1-(4-benzylsulfanylbutyl)-4,5-dihydroimidazole.
| Compound Name | azane;1-(4-benzylsulfanylbutyl)-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 174929488 |
| Molecular Formula | C14H23N3S |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | azane;1-(4-benzylsulfanylbutyl)-4,5-dihydroimidazole |
| SMILES | C1=NCCN1CCCCSCc1ccccc1.N |
| InChI | InChI=1S/C14H20N2S.H3N/c1-2-6-14(7-3-1)12-17-11-5-4-9-16-10-8-15-13-16;/h1-3,6-7,13H,4-5,8-12H2;1H3 |
| InChIKey | LWKCLZJBMKUWMO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|