C18H19NO — CID 174929671
2-[5-[4-(aminomethyl)phenyl]penta-1,4-dienyl]phenol (PubChem CID 174929671) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-[5-[4-(aminomethyl)phenyl]penta-1,4-dienyl]phenol.
| Compound Name | 2-[5-[4-(aminomethyl)phenyl]penta-1,4-dienyl]phenol |
|---|---|
| PubChem CID | 174929671 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-[5-[4-(aminomethyl)phenyl]penta-1,4-dienyl]phenol |
| SMILES | NCc1ccc(C=CCC=Cc2ccccc2O)cc1 |
| InChI | InChI=1S/C18H19NO/c19-14-16-12-10-15(11-13-16)6-2-1-3-7-17-8-4-5-9-18(17)20/h2-13,20H,1,14,19H2 |
| InChIKey | JNMBCRRKGOMPCR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |