About octan-3-yl 2-(methoxymethylidene)butanoate
octan-3-yl 2-(methoxymethylidene)butanoate (PubChem CID 174929674) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is octan-3-yl 2-(methoxymethylidene)butanoate.
Molecular Properties
| Compound Name | octan-3-yl 2-(methoxymethylidene)butanoate |
| PubChem CID | 174929674 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | octan-3-yl 2-(methoxymethylidene)butanoate |
| SMILES | CCCCCC(CC)OC(=O)C(=COC)CC |
| InChI | InChI=1S/C14H26O3/c1-5-8-9-10-13(7-3)17-14(15)12(6-2)11-16-4/h11,13H,5-10H2,1-4H3 |
| InChIKey | ZYPVBMHHTJPAIT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze octan-3-yl 2-(methoxymethylidene)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-3-yl 2-(methoxymethylidene)butanoate?
The IUPAC name of octan-3-yl 2-(methoxymethylidene)butanoate (CID 174929674) is octan-3-yl 2-(methoxymethylidene)butanoate.
What is the SMILES notation for octan-3-yl 2-(methoxymethylidene)butanoate?
The canonical SMILES for octan-3-yl 2-(methoxymethylidene)butanoate is CCCCCC(CC)OC(=O)C(=COC)CC.
What is the InChIKey of octan-3-yl 2-(methoxymethylidene)butanoate?
The InChIKey is ZYPVBMHHTJPAIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3/c1-5-8-9-10-13(7-3)17-14(15)12(6-2)11-16-4/h11,13H,5-10H2,1-4H3.
What are the key properties of octan-3-yl 2-(methoxymethylidene)butanoate?
octan-3-yl 2-(methoxymethylidene)butanoate has a molecular weight of 242.36 g/mol, XLogP of 3.83, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octan-3-yl 2-(methoxymethylidene)butanoate is sourced from PubChem (CID 174929674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).