About 5-ethyl-1,3,5-triazinane-2-carbaldehyde
5-ethyl-1,3,5-triazinane-2-carbaldehyde (PubChem CID 174930544) has the molecular formula C6H13N3O
and a molecular weight of 143.19 g/mol. Its IUPAC name is 5-ethyl-1,3,5-triazinane-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-ethyl-1,3,5-triazinane-2-carbaldehyde |
| PubChem CID | 174930544 |
| Molecular Formula | C6H13N3O |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | 5-ethyl-1,3,5-triazinane-2-carbaldehyde |
| SMILES | CCN1CNC(C=O)NC1 |
| InChI | InChI=1S/C6H13N3O/c1-2-9-4-7-6(3-10)8-5-9/h3,6-8H,2,4-5H2,1H3 |
| InChIKey | SLACQTZYYFFPQY-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-1,3,5-triazinane-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,3,5-triazinane-2-carbaldehyde?
The IUPAC name of 5-ethyl-1,3,5-triazinane-2-carbaldehyde (CID 174930544) is 5-ethyl-1,3,5-triazinane-2-carbaldehyde.
What is the SMILES notation for 5-ethyl-1,3,5-triazinane-2-carbaldehyde?
The canonical SMILES for 5-ethyl-1,3,5-triazinane-2-carbaldehyde is CCN1CNC(C=O)NC1.
What is the InChIKey of 5-ethyl-1,3,5-triazinane-2-carbaldehyde?
The InChIKey is SLACQTZYYFFPQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3O/c1-2-9-4-7-6(3-10)8-5-9/h3,6-8H,2,4-5H2,1H3.
What are the key properties of 5-ethyl-1,3,5-triazinane-2-carbaldehyde?
5-ethyl-1,3,5-triazinane-2-carbaldehyde has a molecular weight of 143.19 g/mol, XLogP of -1.06, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,3,5-triazinane-2-carbaldehyde is sourced from PubChem (CID 174930544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).