About 2-(butylamino)ethanol;7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine
2-(butylamino)ethanol;7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine (PubChem CID 174930791) has the molecular formula C22H29ClN4O2
and a molecular weight of 416.95 g/mol. Its IUPAC name is 2-(butylamino)ethanol;7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine.
Molecular Properties
| Compound Name | 2-(butylamino)ethanol;7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine |
| PubChem CID | 174930791 |
| Molecular Formula | C22H29ClN4O2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 2-(butylamino)ethanol;7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine |
| SMILES | C/N=C1/CN(O)C(c2ccccc2)=c2cc(Cl)ccc2=N1.CCCCNCCO |
| InChI | InChI=1S/C16H14ClN3O.C6H15NO/c1-18-15-10-20(21)16(11-5-3-2-4-6-11)13-9-12(17)7-8-14(13)19-15;1-2-3-4-7-5-6-8/h2-9,21H,10H2,1H3;7-8H,2-6H2,1H3/b18-15-; |
| InChIKey | JYKWWPMLYSZJTF-MWIGPOFTSA-N |
| XLogP | 2.22 |
| TPSA | 80.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(butylamino)ethanol;7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(butylamino)ethanol;7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine?
The IUPAC name of 2-(butylamino)ethanol;7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine (CID 174930791) is 2-(butylamino)ethanol;7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine.
What is the SMILES notation for 2-(butylamino)ethanol;7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine?
The canonical SMILES for 2-(butylamino)ethanol;7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine is C/N=C1/CN(O)C(c2ccccc2)=c2cc(Cl)ccc2=N1.CCCCNCCO.
What is the InChIKey of 2-(butylamino)ethanol;7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine?
The InChIKey is JYKWWPMLYSZJTF-MWIGPOFTSA-N. The full InChI is InChI=1S/C16H14ClN3O.C6H15NO/c1-18-15-10-20(21)16(11-5-3-2-4-6-11)13-9-12(17)7-8-14(13)19-15;1-2-3-4-7-5-6-8/h2-9,21H,10H2,1H3;7-8H,2-6H2,1H3/b18-15-;.
What are the key properties of 2-(butylamino)ethanol;7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine?
2-(butylamino)ethanol;7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine has a molecular weight of 416.95 g/mol, XLogP of 2.22, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butylamino)ethanol;7-chloro-4-hydroxy-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-imine is sourced from PubChem (CID 174930791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).