About 2-hydroxycyclohexa-2,5-diene-1,4-dione;quinoline
2-hydroxycyclohexa-2,5-diene-1,4-dione;quinoline (PubChem CID 174931052) has the molecular formula C15H11NO3
and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-hydroxycyclohexa-2,5-diene-1,4-dione;quinoline.
Molecular Properties
| Compound Name | 2-hydroxycyclohexa-2,5-diene-1,4-dione;quinoline |
| PubChem CID | 174931052 |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-hydroxycyclohexa-2,5-diene-1,4-dione;quinoline |
| SMILES | O=C1C=CC(=O)C(O)=C1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C6H4O3/c1-2-6-9-8(4-1)5-3-7-10-9;7-4-1-2-5(8)6(9)3-4/h1-7H;1-3,9H |
| InChIKey | ABQNIILXRLIKJN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxycyclohexa-2,5-diene-1,4-dione;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxycyclohexa-2,5-diene-1,4-dione;quinoline?
The IUPAC name of 2-hydroxycyclohexa-2,5-diene-1,4-dione;quinoline (CID 174931052) is 2-hydroxycyclohexa-2,5-diene-1,4-dione;quinoline.
What is the SMILES notation for 2-hydroxycyclohexa-2,5-diene-1,4-dione;quinoline?
The canonical SMILES for 2-hydroxycyclohexa-2,5-diene-1,4-dione;quinoline is O=C1C=CC(=O)C(O)=C1.c1ccc2ncccc2c1.
What is the InChIKey of 2-hydroxycyclohexa-2,5-diene-1,4-dione;quinoline?
The InChIKey is ABQNIILXRLIKJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C6H4O3/c1-2-6-9-8(4-1)5-3-7-10-9;7-4-1-2-5(8)6(9)3-4/h1-7H;1-3,9H.
What are the key properties of 2-hydroxycyclohexa-2,5-diene-1,4-dione;quinoline?
2-hydroxycyclohexa-2,5-diene-1,4-dione;quinoline has a molecular weight of 253.26 g/mol, XLogP of 2.37, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxycyclohexa-2,5-diene-1,4-dione;quinoline is sourced from PubChem (CID 174931052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).