About 2,2-dimethyl-1,3-dihydroindole-5-carboxamide
2,2-dimethyl-1,3-dihydroindole-5-carboxamide (PubChem CID 174931902) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dihydroindole-5-carboxamide.
Molecular Properties
| Compound Name | 2,2-dimethyl-1,3-dihydroindole-5-carboxamide |
| PubChem CID | 174931902 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2,2-dimethyl-1,3-dihydroindole-5-carboxamide |
| SMILES | CC1(C)Cc2cc(C(N)=O)ccc2N1 |
| InChI | InChI=1S/C11H14N2O/c1-11(2)6-8-5-7(10(12)14)3-4-9(8)13-11/h3-5,13H,6H2,1-2H3,(H2,12,14) |
| InChIKey | STUOCAAKXPHYSN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethyl-1,3-dihydroindole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1,3-dihydroindole-5-carboxamide?
The IUPAC name of 2,2-dimethyl-1,3-dihydroindole-5-carboxamide (CID 174931902) is 2,2-dimethyl-1,3-dihydroindole-5-carboxamide.
What is the SMILES notation for 2,2-dimethyl-1,3-dihydroindole-5-carboxamide?
The canonical SMILES for 2,2-dimethyl-1,3-dihydroindole-5-carboxamide is CC1(C)Cc2cc(C(N)=O)ccc2N1.
What is the InChIKey of 2,2-dimethyl-1,3-dihydroindole-5-carboxamide?
The InChIKey is STUOCAAKXPHYSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-11(2)6-8-5-7(10(12)14)3-4-9(8)13-11/h3-5,13H,6H2,1-2H3,(H2,12,14).
What are the key properties of 2,2-dimethyl-1,3-dihydroindole-5-carboxamide?
2,2-dimethyl-1,3-dihydroindole-5-carboxamide has a molecular weight of 190.25 g/mol, XLogP of 1.53, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1,3-dihydroindole-5-carboxamide is sourced from PubChem (CID 174931902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).