C9H13Cl2N3 — CID 174932005
1,4-dimethylbenzimidazol-2-amine;dihydrochloride (PubChem CID 174932005) has the molecular formula C9H13Cl2N3 and a molecular weight of 234.13 g/mol. Its IUPAC name is 1,4-dimethylbenzimidazol-2-amine;dihydrochloride.
| Compound Name | 1,4-dimethylbenzimidazol-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 174932005 |
| Molecular Formula | C9H13Cl2N3 |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 1,4-dimethylbenzimidazol-2-amine;dihydrochloride |
| SMILES | Cc1cccc2c1nc(N)n2C.Cl.Cl |
| InChI | InChI=1S/C9H11N3.2ClH/c1-6-4-3-5-7-8(6)11-9(10)12(7)2;;/h3-5H,1-2H3,(H2,10,11);2*1H |
| InChIKey | UJRRTVWSLLUHOS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |