About 3-ethenylpyrrolidin-2-one;1-propan-2-ylidenepiperidin-1-ium;chloride
3-ethenylpyrrolidin-2-one;1-propan-2-ylidenepiperidin-1-ium;chloride (PubChem CID 174932057) has the molecular formula C14H25ClN2O
and a molecular weight of 272.82 g/mol. Its IUPAC name is 3-ethenylpyrrolidin-2-one;1-propan-2-ylidenepiperidin-1-ium;chloride.
Molecular Properties
| Compound Name | 3-ethenylpyrrolidin-2-one;1-propan-2-ylidenepiperidin-1-ium;chloride |
| PubChem CID | 174932057 |
| Molecular Formula | C14H25ClN2O |
| Molecular Weight | 272.82 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 3-ethenylpyrrolidin-2-one;1-propan-2-ylidenepiperidin-1-ium;chloride |
| SMILES | C=CC1CCNC1=O.CC(C)=[N+]1CCCCC1.[Cl-] |
| InChI | InChI=1S/C8H16N.C6H9NO.ClH/c1-8(2)9-6-4-3-5-7-9;1-2-5-3-4-7-6(5)8;/h3-7H2,1-2H3;2,5H,1,3-4H2,(H,7,8);1H/q+1;;/p-1 |
| InChIKey | NOEMLTSXTFILAQ-UHFFFAOYSA-M |
| XLogP | -1.02 |
| TPSA | 32.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.82 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenylpyrrolidin-2-one;1-propan-2-ylidenepiperidin-1-ium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenylpyrrolidin-2-one;1-propan-2-ylidenepiperidin-1-ium;chloride?
The IUPAC name of 3-ethenylpyrrolidin-2-one;1-propan-2-ylidenepiperidin-1-ium;chloride (CID 174932057) is 3-ethenylpyrrolidin-2-one;1-propan-2-ylidenepiperidin-1-ium;chloride.
What is the SMILES notation for 3-ethenylpyrrolidin-2-one;1-propan-2-ylidenepiperidin-1-ium;chloride?
The canonical SMILES for 3-ethenylpyrrolidin-2-one;1-propan-2-ylidenepiperidin-1-ium;chloride is C=CC1CCNC1=O.CC(C)=[N+]1CCCCC1.[Cl-].
What is the InChIKey of 3-ethenylpyrrolidin-2-one;1-propan-2-ylidenepiperidin-1-ium;chloride?
The InChIKey is NOEMLTSXTFILAQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16N.C6H9NO.ClH/c1-8(2)9-6-4-3-5-7-9;1-2-5-3-4-7-6(5)8;/h3-7H2,1-2H3;2,5H,1,3-4H2,(H,7,8);1H/q+1;;/p-1.
What are the key properties of 3-ethenylpyrrolidin-2-one;1-propan-2-ylidenepiperidin-1-ium;chloride?
3-ethenylpyrrolidin-2-one;1-propan-2-ylidenepiperidin-1-ium;chloride has a molecular weight of 272.82 g/mol, XLogP of -1.02, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenylpyrrolidin-2-one;1-propan-2-ylidenepiperidin-1-ium;chloride is sourced from PubChem (CID 174932057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).