About potassium;2-ethoxyethanol;hexafluorophosphate
potassium;2-ethoxyethanol;hexafluorophosphate (PubChem CID 174932097) has the molecular formula C4H10F6KO2P
and a molecular weight of 274.18 g/mol. Its IUPAC name is potassium;2-ethoxyethanol;hexafluorophosphate.
Molecular Properties
| Compound Name | potassium;2-ethoxyethanol;hexafluorophosphate |
| PubChem CID | 174932097 |
| Molecular Formula | C4H10F6KO2P |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | potassium;2-ethoxyethanol;hexafluorophosphate |
| SMILES | CCOCCO.F[P-](F)(F)(F)(F)F.[K+] |
| InChI | InChI=1S/C4H10O2.F6P.K/c1-2-6-4-3-5;1-7(2,3,4,5)6;/h5H,2-4H2,1H3;;/q;-1;+1 |
| InChIKey | MJMRJBKGXNBTHL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze potassium;2-ethoxyethanol;hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2-ethoxyethanol;hexafluorophosphate?
The IUPAC name of potassium;2-ethoxyethanol;hexafluorophosphate (CID 174932097) is potassium;2-ethoxyethanol;hexafluorophosphate.
What is the SMILES notation for potassium;2-ethoxyethanol;hexafluorophosphate?
The canonical SMILES for potassium;2-ethoxyethanol;hexafluorophosphate is CCOCCO.F[P-](F)(F)(F)(F)F.[K+].
What is the InChIKey of potassium;2-ethoxyethanol;hexafluorophosphate?
The InChIKey is MJMRJBKGXNBTHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.F6P.K/c1-2-6-4-3-5;1-7(2,3,4,5)6;/h5H,2-4H2,1H3;;/q;-1;+1.
What are the key properties of potassium;2-ethoxyethanol;hexafluorophosphate?
potassium;2-ethoxyethanol;hexafluorophosphate has a molecular weight of 274.18 g/mol, XLogP of 0.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2-ethoxyethanol;hexafluorophosphate is sourced from PubChem (CID 174932097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).