C22H24FN3O3S — CID 17493212
N-[1-(4-fluorophenyl)ethyl]-N-methyl-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide (PubChem CID 17493212) has the molecular formula C22H24FN3O3S and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)ethyl]-N-methyl-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide.
| Compound Name | N-[1-(4-fluorophenyl)ethyl]-N-methyl-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 17493212 |
| Molecular Formula | C22H24FN3O3S |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-[1-(4-fluorophenyl)ethyl]-N-methyl-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
| SMILES | CC(c1ccc(F)cc1)N(C)C(=O)c1ccc2c(c1)S(=O)(=O)N=C1CCCCCN12 |
| InChI | InChI=1S/C22H24FN3O3S/c1-15(16-7-10-18(23)11-8-16)25(2)22(27)17-9-12-19-20(14-17)30(28,29)24-21-6-4-3-5-13-26(19)21/h7-12,14-15H,3-6,13H2,1-2H3 |
| InChIKey | HASZBKUBORIPRJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |