About magnesium;dichloropalladium;sulfate
magnesium;dichloropalladium;sulfate (PubChem CID 174932623) has the molecular formula Cl2MgO4PdS
and a molecular weight of 297.69 g/mol. Its IUPAC name is magnesium;dichloropalladium;sulfate.
Molecular Properties
| Compound Name | magnesium;dichloropalladium;sulfate |
| PubChem CID | 174932623 |
| Molecular Formula | Cl2MgO4PdS |
| Molecular Weight | 297.69 g/mol |
| Exact Mass | 295.78 |
| IUPAC Name | magnesium;dichloropalladium;sulfate |
| SMILES | Cl[Pd]Cl.O=S(=O)([O-])[O-].[Mg+2] |
| InChI | InChI=1S/2ClH.Mg.H2O4S.Pd/c;;;1-5(2,3)4;/h2*1H;;(H2,1,2,3,4);/q;;+2;;+2/p-4 |
| InChIKey | MLPDSDIKAOIINU-UHFFFAOYSA-J |
| XLogP | -0.34 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.69 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze magnesium;dichloropalladium;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;dichloropalladium;sulfate?
The IUPAC name of magnesium;dichloropalladium;sulfate (CID 174932623) is magnesium;dichloropalladium;sulfate.
What is the SMILES notation for magnesium;dichloropalladium;sulfate?
The canonical SMILES for magnesium;dichloropalladium;sulfate is Cl[Pd]Cl.O=S(=O)([O-])[O-].[Mg+2].
What is the InChIKey of magnesium;dichloropalladium;sulfate?
The InChIKey is MLPDSDIKAOIINU-UHFFFAOYSA-J. The full InChI is InChI=1S/2ClH.Mg.H2O4S.Pd/c;;;1-5(2,3)4;/h2*1H;;(H2,1,2,3,4);/q;;+2;;+2/p-4.
What are the key properties of magnesium;dichloropalladium;sulfate?
magnesium;dichloropalladium;sulfate has a molecular weight of 297.69 g/mol, XLogP of -0.34, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;dichloropalladium;sulfate is sourced from PubChem (CID 174932623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).