C13H16O3 — CID 174932626
3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;penta-1,3-diene (PubChem CID 174932626) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;penta-1,3-diene.
| Compound Name | 3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;penta-1,3-diene |
|---|---|
| PubChem CID | 174932626 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;penta-1,3-diene |
| SMILES | C=CC=CC.O=C1OC(=O)C2CCC=CC12 |
| InChI | InChI=1S/C8H8O3.C5H8/c9-7-5-3-1-2-4-6(5)8(10)11-7;1-3-5-4-2/h1,3,5-6H,2,4H2;3-5H,1H2,2H3 |
| InChIKey | CLASVUSOMGUXIX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|