About lithium;tert-butyl(dimethyl)silanide;hexane
lithium;tert-butyl(dimethyl)silanide;hexane (PubChem CID 174932698) has the molecular formula C12H29LiSi
and a molecular weight of 208.39 g/mol. Its IUPAC name is lithium;tert-butyl(dimethyl)silanide;hexane.
Molecular Properties
| Compound Name | lithium;tert-butyl(dimethyl)silanide;hexane |
| PubChem CID | 174932698 |
| Molecular Formula | C12H29LiSi |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | lithium;tert-butyl(dimethyl)silanide;hexane |
| SMILES | CCCCCC.C[Si-](C)C(C)(C)C.[Li+] |
| InChI | InChI=1S/C6H15Si.C6H14.Li/c1-6(2,3)7(4)5;1-3-5-6-4-2;/h1-5H3;3-6H2,1-2H3;/q-1;;+1 |
| InChIKey | NZXOGMVDMDVXCI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze lithium;tert-butyl(dimethyl)silanide;hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;tert-butyl(dimethyl)silanide;hexane?
The IUPAC name of lithium;tert-butyl(dimethyl)silanide;hexane (CID 174932698) is lithium;tert-butyl(dimethyl)silanide;hexane.
What is the SMILES notation for lithium;tert-butyl(dimethyl)silanide;hexane?
The canonical SMILES for lithium;tert-butyl(dimethyl)silanide;hexane is CCCCCC.C[Si-](C)C(C)(C)C.[Li+].
What is the InChIKey of lithium;tert-butyl(dimethyl)silanide;hexane?
The InChIKey is NZXOGMVDMDVXCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15Si.C6H14.Li/c1-6(2,3)7(4)5;1-3-5-6-4-2;/h1-5H3;3-6H2,1-2H3;/q-1;;+1.
What are the key properties of lithium;tert-butyl(dimethyl)silanide;hexane?
lithium;tert-butyl(dimethyl)silanide;hexane has a molecular weight of 208.39 g/mol, XLogP of 2.13, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;tert-butyl(dimethyl)silanide;hexane is sourced from PubChem (CID 174932698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).