About chrysene;[(2S)-1-methylpyrrolidin-2-yl]methanol
chrysene;[(2S)-1-methylpyrrolidin-2-yl]methanol (PubChem CID 174932756) has the molecular formula C24H25NO
and a molecular weight of 343.47 g/mol. Its IUPAC name is chrysene;[(2S)-1-methylpyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | chrysene;[(2S)-1-methylpyrrolidin-2-yl]methanol |
| PubChem CID | 174932756 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | chrysene;[(2S)-1-methylpyrrolidin-2-yl]methanol |
| SMILES | CN1CCC[C@H]1CO.c1ccc2c(c1)ccc1c3ccccc3ccc21 |
| InChI | InChI=1S/C18H12.C6H13NO/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-7-4-2-3-6(7)5-8/h1-12H;6,8H,2-5H2,1H3/t;6-/m.0/s1 |
| InChIKey | VADXZBRZZXFKAX-ZCMDIHMWSA-N |
| XLogP | 5.22 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze chrysene;[(2S)-1-methylpyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chrysene;[(2S)-1-methylpyrrolidin-2-yl]methanol?
The IUPAC name of chrysene;[(2S)-1-methylpyrrolidin-2-yl]methanol (CID 174932756) is chrysene;[(2S)-1-methylpyrrolidin-2-yl]methanol.
What is the SMILES notation for chrysene;[(2S)-1-methylpyrrolidin-2-yl]methanol?
The canonical SMILES for chrysene;[(2S)-1-methylpyrrolidin-2-yl]methanol is CN1CCC[C@H]1CO.c1ccc2c(c1)ccc1c3ccccc3ccc21.
What is the InChIKey of chrysene;[(2S)-1-methylpyrrolidin-2-yl]methanol?
The InChIKey is VADXZBRZZXFKAX-ZCMDIHMWSA-N. The full InChI is InChI=1S/C18H12.C6H13NO/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-7-4-2-3-6(7)5-8/h1-12H;6,8H,2-5H2,1H3/t;6-/m.0/s1.
What are the key properties of chrysene;[(2S)-1-methylpyrrolidin-2-yl]methanol?
chrysene;[(2S)-1-methylpyrrolidin-2-yl]methanol has a molecular weight of 343.47 g/mol, XLogP of 5.22, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chrysene;[(2S)-1-methylpyrrolidin-2-yl]methanol is sourced from PubChem (CID 174932756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).