About (1-oxo-1-phenylbutan-2-yl) formate;N-propan-2-ylpropan-2-amine
(1-oxo-1-phenylbutan-2-yl) formate;N-propan-2-ylpropan-2-amine (PubChem CID 174932868) has the molecular formula C17H27NO3
and a molecular weight of 293.41 g/mol. Its IUPAC name is (1-oxo-1-phenylbutan-2-yl) formate;N-propan-2-ylpropan-2-amine.
Molecular Properties
| Compound Name | (1-oxo-1-phenylbutan-2-yl) formate;N-propan-2-ylpropan-2-amine |
| PubChem CID | 174932868 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | (1-oxo-1-phenylbutan-2-yl) formate;N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)NC(C)C.CCC(OC=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C11H12O3.C6H15N/c1-2-10(14-8-12)11(13)9-6-4-3-5-7-9;1-5(2)7-6(3)4/h3-8,10H,2H2,1H3;5-7H,1-4H3 |
| InChIKey | JMXDYAODZQNSAF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (1-oxo-1-phenylbutan-2-yl) formate;N-propan-2-ylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-oxo-1-phenylbutan-2-yl) formate;N-propan-2-ylpropan-2-amine?
The IUPAC name of (1-oxo-1-phenylbutan-2-yl) formate;N-propan-2-ylpropan-2-amine (CID 174932868) is (1-oxo-1-phenylbutan-2-yl) formate;N-propan-2-ylpropan-2-amine.
What is the SMILES notation for (1-oxo-1-phenylbutan-2-yl) formate;N-propan-2-ylpropan-2-amine?
The canonical SMILES for (1-oxo-1-phenylbutan-2-yl) formate;N-propan-2-ylpropan-2-amine is CC(C)NC(C)C.CCC(OC=O)C(=O)c1ccccc1.
What is the InChIKey of (1-oxo-1-phenylbutan-2-yl) formate;N-propan-2-ylpropan-2-amine?
The InChIKey is JMXDYAODZQNSAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3.C6H15N/c1-2-10(14-8-12)11(13)9-6-4-3-5-7-9;1-5(2)7-6(3)4/h3-8,10H,2H2,1H3;5-7H,1-4H3.
What are the key properties of (1-oxo-1-phenylbutan-2-yl) formate;N-propan-2-ylpropan-2-amine?
(1-oxo-1-phenylbutan-2-yl) formate;N-propan-2-ylpropan-2-amine has a molecular weight of 293.41 g/mol, XLogP of 3.21, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-oxo-1-phenylbutan-2-yl) formate;N-propan-2-ylpropan-2-amine is sourced from PubChem (CID 174932868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).