About 2-aminophenol;1-methyl-1-propylcyclopentane
2-aminophenol;1-methyl-1-propylcyclopentane (PubChem CID 174933153) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-aminophenol;1-methyl-1-propylcyclopentane.
Molecular Properties
| Compound Name | 2-aminophenol;1-methyl-1-propylcyclopentane |
| PubChem CID | 174933153 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 2-aminophenol;1-methyl-1-propylcyclopentane |
| SMILES | CCCC1(C)CCCC1.Nc1ccccc1O |
| InChI | InChI=1S/C9H18.C6H7NO/c1-3-6-9(2)7-4-5-8-9;7-5-3-1-2-4-6(5)8/h3-8H2,1-2H3;1-4,8H,7H2 |
| InChIKey | IOXMLKGKTXGFEA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-aminophenol;1-methyl-1-propylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminophenol;1-methyl-1-propylcyclopentane?
The IUPAC name of 2-aminophenol;1-methyl-1-propylcyclopentane (CID 174933153) is 2-aminophenol;1-methyl-1-propylcyclopentane.
What is the SMILES notation for 2-aminophenol;1-methyl-1-propylcyclopentane?
The canonical SMILES for 2-aminophenol;1-methyl-1-propylcyclopentane is CCCC1(C)CCCC1.Nc1ccccc1O.
What is the InChIKey of 2-aminophenol;1-methyl-1-propylcyclopentane?
The InChIKey is IOXMLKGKTXGFEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C6H7NO/c1-3-6-9(2)7-4-5-8-9;7-5-3-1-2-4-6(5)8/h3-8H2,1-2H3;1-4,8H,7H2.
What are the key properties of 2-aminophenol;1-methyl-1-propylcyclopentane?
2-aminophenol;1-methyl-1-propylcyclopentane has a molecular weight of 235.37 g/mol, XLogP of 4.34, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminophenol;1-methyl-1-propylcyclopentane is sourced from PubChem (CID 174933153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).