About 4-aminobenzenesulfonamide;1-bromo-2-(trifluoromethyl)benzene
4-aminobenzenesulfonamide;1-bromo-2-(trifluoromethyl)benzene (PubChem CID 174933416) has the molecular formula C13H12BrF3N2O2S
and a molecular weight of 397.22 g/mol. Its IUPAC name is 4-aminobenzenesulfonamide;1-bromo-2-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 4-aminobenzenesulfonamide;1-bromo-2-(trifluoromethyl)benzene |
| PubChem CID | 174933416 |
| Molecular Formula | C13H12BrF3N2O2S |
| Molecular Weight | 397.22 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | 4-aminobenzenesulfonamide;1-bromo-2-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1ccccc1Br.Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C7H4BrF3.C6H8N2O2S/c8-6-4-2-1-3-5(6)7(9,10)11;7-5-1-3-6(4-2-5)11(8,9)10/h1-4H;1-4H,7H2,(H2,8,9,10) |
| InChIKey | YTHRTWCOOBLFBE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.22 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzenesulfonamide;1-bromo-2-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzenesulfonamide;1-bromo-2-(trifluoromethyl)benzene?
The IUPAC name of 4-aminobenzenesulfonamide;1-bromo-2-(trifluoromethyl)benzene (CID 174933416) is 4-aminobenzenesulfonamide;1-bromo-2-(trifluoromethyl)benzene.
What is the SMILES notation for 4-aminobenzenesulfonamide;1-bromo-2-(trifluoromethyl)benzene?
The canonical SMILES for 4-aminobenzenesulfonamide;1-bromo-2-(trifluoromethyl)benzene is FC(F)(F)c1ccccc1Br.Nc1ccc(S(N)(=O)=O)cc1.
What is the InChIKey of 4-aminobenzenesulfonamide;1-bromo-2-(trifluoromethyl)benzene?
The InChIKey is YTHRTWCOOBLFBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrF3.C6H8N2O2S/c8-6-4-2-1-3-5(6)7(9,10)11;7-5-1-3-6(4-2-5)11(8,9)10/h1-4H;1-4H,7H2,(H2,8,9,10).
What are the key properties of 4-aminobenzenesulfonamide;1-bromo-2-(trifluoromethyl)benzene?
4-aminobenzenesulfonamide;1-bromo-2-(trifluoromethyl)benzene has a molecular weight of 397.22 g/mol, XLogP of 3.38, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzenesulfonamide;1-bromo-2-(trifluoromethyl)benzene is sourced from PubChem (CID 174933416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).