About ethyl 2-(C,N-dimethylcarbonimidoyl)-3-hydroxybut-2-enoate
ethyl 2-(C,N-dimethylcarbonimidoyl)-3-hydroxybut-2-enoate (PubChem CID 174933447) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is ethyl 2-(C,N-dimethylcarbonimidoyl)-3-hydroxybut-2-enoate.
Molecular Properties
| Compound Name | ethyl 2-(C,N-dimethylcarbonimidoyl)-3-hydroxybut-2-enoate |
| PubChem CID | 174933447 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | ethyl 2-(C,N-dimethylcarbonimidoyl)-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(=C(C)O)/C(C)=N/C |
| InChI | InChI=1S/C9H15NO3/c1-5-13-9(12)8(7(3)11)6(2)10-4/h11H,5H2,1-4H3/b8-7?,10-6+ |
| InChIKey | BNWRWMOWAMUNJF-BNWZXCCZSA-N |
| XLogP | 1.47 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(C,N-dimethylcarbonimidoyl)-3-hydroxybut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(C,N-dimethylcarbonimidoyl)-3-hydroxybut-2-enoate?
The IUPAC name of ethyl 2-(C,N-dimethylcarbonimidoyl)-3-hydroxybut-2-enoate (CID 174933447) is ethyl 2-(C,N-dimethylcarbonimidoyl)-3-hydroxybut-2-enoate.
What is the SMILES notation for ethyl 2-(C,N-dimethylcarbonimidoyl)-3-hydroxybut-2-enoate?
The canonical SMILES for ethyl 2-(C,N-dimethylcarbonimidoyl)-3-hydroxybut-2-enoate is CCOC(=O)C(=C(C)O)/C(C)=N/C.
What is the InChIKey of ethyl 2-(C,N-dimethylcarbonimidoyl)-3-hydroxybut-2-enoate?
The InChIKey is BNWRWMOWAMUNJF-BNWZXCCZSA-N. The full InChI is InChI=1S/C9H15NO3/c1-5-13-9(12)8(7(3)11)6(2)10-4/h11H,5H2,1-4H3/b8-7?,10-6+.
What are the key properties of ethyl 2-(C,N-dimethylcarbonimidoyl)-3-hydroxybut-2-enoate?
ethyl 2-(C,N-dimethylcarbonimidoyl)-3-hydroxybut-2-enoate has a molecular weight of 185.22 g/mol, XLogP of 1.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(C,N-dimethylcarbonimidoyl)-3-hydroxybut-2-enoate is sourced from PubChem (CID 174933447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).