About carbamic acid;N,N'-dicyclohexylmethanediimine
carbamic acid;N,N'-dicyclohexylmethanediimine (PubChem CID 174934245) has the molecular formula C14H25N3O2
and a molecular weight of 267.37 g/mol. Its IUPAC name is carbamic acid;N,N'-dicyclohexylmethanediimine.
Molecular Properties
| Compound Name | carbamic acid;N,N'-dicyclohexylmethanediimine |
| PubChem CID | 174934245 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | carbamic acid;N,N'-dicyclohexylmethanediimine |
| SMILES | C(=NC1CCCCC1)=NC1CCCCC1.NC(=O)O |
| InChI | InChI=1S/C13H22N2.CH3NO2/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;2-1(3)4/h12-13H,1-10H2;2H2,(H,3,4) |
| InChIKey | NPYILGKPZXNXID-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze carbamic acid;N,N'-dicyclohexylmethanediimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;N,N'-dicyclohexylmethanediimine?
The IUPAC name of carbamic acid;N,N'-dicyclohexylmethanediimine (CID 174934245) is carbamic acid;N,N'-dicyclohexylmethanediimine.
What is the SMILES notation for carbamic acid;N,N'-dicyclohexylmethanediimine?
The canonical SMILES for carbamic acid;N,N'-dicyclohexylmethanediimine is C(=NC1CCCCC1)=NC1CCCCC1.NC(=O)O.
What is the InChIKey of carbamic acid;N,N'-dicyclohexylmethanediimine?
The InChIKey is NPYILGKPZXNXID-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2.CH3NO2/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;2-1(3)4/h12-13H,1-10H2;2H2,(H,3,4).
What are the key properties of carbamic acid;N,N'-dicyclohexylmethanediimine?
carbamic acid;N,N'-dicyclohexylmethanediimine has a molecular weight of 267.37 g/mol, XLogP of 3.45, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;N,N'-dicyclohexylmethanediimine is sourced from PubChem (CID 174934245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).