About (3-fluoro-3-hydroxy-1,2-dihydroinden-2-yl) carbamate
(3-fluoro-3-hydroxy-1,2-dihydroinden-2-yl) carbamate (PubChem CID 174934664) has the molecular formula C10H10FNO3
and a molecular weight of 211.19 g/mol. Its IUPAC name is (3-fluoro-3-hydroxy-1,2-dihydroinden-2-yl) carbamate.
Molecular Properties
| Compound Name | (3-fluoro-3-hydroxy-1,2-dihydroinden-2-yl) carbamate |
| PubChem CID | 174934664 |
| Molecular Formula | C10H10FNO3 |
| Molecular Weight | 211.19 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | (3-fluoro-3-hydroxy-1,2-dihydroinden-2-yl) carbamate |
| SMILES | NC(=O)OC1Cc2ccccc2C1(O)F |
| InChI | InChI=1S/C10H10FNO3/c11-10(14)7-4-2-1-3-6(7)5-8(10)15-9(12)13/h1-4,8,14H,5H2,(H2,12,13) |
| InChIKey | MSSYSKPIXNBBCE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.19 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-fluoro-3-hydroxy-1,2-dihydroinden-2-yl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluoro-3-hydroxy-1,2-dihydroinden-2-yl) carbamate?
The IUPAC name of (3-fluoro-3-hydroxy-1,2-dihydroinden-2-yl) carbamate (CID 174934664) is (3-fluoro-3-hydroxy-1,2-dihydroinden-2-yl) carbamate.
What is the SMILES notation for (3-fluoro-3-hydroxy-1,2-dihydroinden-2-yl) carbamate?
The canonical SMILES for (3-fluoro-3-hydroxy-1,2-dihydroinden-2-yl) carbamate is NC(=O)OC1Cc2ccccc2C1(O)F.
What is the InChIKey of (3-fluoro-3-hydroxy-1,2-dihydroinden-2-yl) carbamate?
The InChIKey is MSSYSKPIXNBBCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO3/c11-10(14)7-4-2-1-3-6(7)5-8(10)15-9(12)13/h1-4,8,14H,5H2,(H2,12,13).
What are the key properties of (3-fluoro-3-hydroxy-1,2-dihydroinden-2-yl) carbamate?
(3-fluoro-3-hydroxy-1,2-dihydroinden-2-yl) carbamate has a molecular weight of 211.19 g/mol, XLogP of 0.82, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluoro-3-hydroxy-1,2-dihydroinden-2-yl) carbamate is sourced from PubChem (CID 174934664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).