C24H28F6 — CID 174934779
1-[2-(3,5-dimethylphenyl)-3,5-difluoro-1-(1,2,3,3-tetrafluoropropyl)pentyl]-3,5-dimethylbenzene (PubChem CID 174934779) has the molecular formula C24H28F6 and a molecular weight of 430.48 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylphenyl)-3,5-difluoro-1-(1,2,3,3-tetrafluoropropyl)pentyl]-3,5-dimethylbenzene.
| Compound Name | 1-[2-(3,5-dimethylphenyl)-3,5-difluoro-1-(1,2,3,3-tetrafluoropropyl)pentyl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 174934779 |
| Molecular Formula | C24H28F6 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 1-[2-(3,5-dimethylphenyl)-3,5-difluoro-1-(1,2,3,3-tetrafluoropropyl)pentyl]-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(C(C(F)CCF)C(c2cc(C)cc(C)c2)C(F)C(F)C(F)F)c1 |
| InChI | InChI=1S/C24H28F6/c1-13-7-14(2)10-17(9-13)20(19(26)5-6-25)21(22(27)23(28)24(29)30)18-11-15(3)8-16(4)12-18/h7-12,19-24H,5-6H2,1-4H3 |
| InChIKey | IQGHTZTZUMMSED-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |