C7H13ClF3N2O3S- — CID 174935060
(4R)-4-amino-5-oxo-5-(2,2,2-trifluoroethylamino)pentane-1-sulfinate;hydrochloride (PubChem CID 174935060) has the molecular formula C7H13ClF3N2O3S- and a molecular weight of 297.71 g/mol. Its IUPAC name is (4R)-4-amino-5-oxo-5-(2,2,2-trifluoroethylamino)pentane-1-sulfinate;hydrochloride.
| Compound Name | (4R)-4-amino-5-oxo-5-(2,2,2-trifluoroethylamino)pentane-1-sulfinate;hydrochloride |
|---|---|
| PubChem CID | 174935060 |
| Molecular Formula | C7H13ClF3N2O3S- |
| Molecular Weight | 297.71 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | (4R)-4-amino-5-oxo-5-(2,2,2-trifluoroethylamino)pentane-1-sulfinate;hydrochloride |
| SMILES | Cl.N[C@H](CCCS(=O)[O-])C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H13F3N2O3S.ClH/c8-7(9,10)4-12-6(13)5(11)2-1-3-16(14)15;/h5H,1-4,11H2,(H,12,13)(H,14,15);1H/p-1/t5-;/m1./s1 |
| InChIKey | IVCWOHWXZKZUJT-NUBCRITNSA-M |
| XLogP | 0.07 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.71 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|