C21H20N4 — CID 174935585
3-(4-methylphenyl)-3,6-diphenyl-2,4-dihydro-1H-1,2,4,5-tetrazine (PubChem CID 174935585) has the molecular formula C21H20N4 and a molecular weight of 328.42 g/mol. Its IUPAC name is 3-(4-methylphenyl)-3,6-diphenyl-2,4-dihydro-1H-1,2,4,5-tetrazine.
| Compound Name | 3-(4-methylphenyl)-3,6-diphenyl-2,4-dihydro-1H-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 174935585 |
| Molecular Formula | C21H20N4 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 3-(4-methylphenyl)-3,6-diphenyl-2,4-dihydro-1H-1,2,4,5-tetrazine |
| SMILES | Cc1ccc(C2(c3ccccc3)NN=C(c3ccccc3)NN2)cc1 |
| InChI | InChI=1S/C21H20N4/c1-16-12-14-19(15-13-16)21(18-10-6-3-7-11-18)24-22-20(23-25-21)17-8-4-2-5-9-17/h2-15,24-25H,1H3,(H,22,23) |
| InChIKey | QLUZLSVSUXCKTG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |