C4H2N10O4 — CID 174936040
(1,5-dinitro-1,2,4-triazol-3-yl)-(1H-1,2,4-triazol-5-yl)diazene (PubChem CID 174936040) has the molecular formula C4H2N10O4 and a molecular weight of 254.13 g/mol. Its IUPAC name is (1,5-dinitro-1,2,4-triazol-3-yl)-(1H-1,2,4-triazol-5-yl)diazene.
| Compound Name | (1,5-dinitro-1,2,4-triazol-3-yl)-(1H-1,2,4-triazol-5-yl)diazene |
|---|---|
| PubChem CID | 174936040 |
| Molecular Formula | C4H2N10O4 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | (1,5-dinitro-1,2,4-triazol-3-yl)-(1H-1,2,4-triazol-5-yl)diazene |
| SMILES | O=[N+]([O-])c1nc(N=Nc2ncn[nH]2)nn1[N+](=O)[O-] |
| InChI | InChI=1S/C4H2N10O4/c15-13(16)4-7-3(11-12(4)14(17)18)10-9-2-5-1-6-8-2/h1H,(H,5,6,8) |
| InChIKey | CYXWRCTZOHOLLH-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 183.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|