About 3,5-dimethyl-4-(methylaminomethyl)aniline;1H-pyrazole-4-carboxylic acid
3,5-dimethyl-4-(methylaminomethyl)aniline;1H-pyrazole-4-carboxylic acid (PubChem CID 174936436) has the molecular formula C14H20N4O2
and a molecular weight of 276.34 g/mol. Its IUPAC name is 3,5-dimethyl-4-(methylaminomethyl)aniline;1H-pyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 3,5-dimethyl-4-(methylaminomethyl)aniline;1H-pyrazole-4-carboxylic acid |
| PubChem CID | 174936436 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3,5-dimethyl-4-(methylaminomethyl)aniline;1H-pyrazole-4-carboxylic acid |
| SMILES | CNCc1c(C)cc(N)cc1C.O=C(O)c1cn[nH]c1 |
| InChI | InChI=1S/C10H16N2.C4H4N2O2/c1-7-4-9(11)5-8(2)10(7)6-12-3;7-4(8)3-1-5-6-2-3/h4-5,12H,6,11H2,1-3H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | BZBNVTSZDFKFRT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-4-(methylaminomethyl)aniline;1H-pyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-4-(methylaminomethyl)aniline;1H-pyrazole-4-carboxylic acid?
The IUPAC name of 3,5-dimethyl-4-(methylaminomethyl)aniline;1H-pyrazole-4-carboxylic acid (CID 174936436) is 3,5-dimethyl-4-(methylaminomethyl)aniline;1H-pyrazole-4-carboxylic acid.
What is the SMILES notation for 3,5-dimethyl-4-(methylaminomethyl)aniline;1H-pyrazole-4-carboxylic acid?
The canonical SMILES for 3,5-dimethyl-4-(methylaminomethyl)aniline;1H-pyrazole-4-carboxylic acid is CNCc1c(C)cc(N)cc1C.O=C(O)c1cn[nH]c1.
What is the InChIKey of 3,5-dimethyl-4-(methylaminomethyl)aniline;1H-pyrazole-4-carboxylic acid?
The InChIKey is BZBNVTSZDFKFRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2.C4H4N2O2/c1-7-4-9(11)5-8(2)10(7)6-12-3;7-4(8)3-1-5-6-2-3/h4-5,12H,6,11H2,1-3H3;1-2H,(H,5,6)(H,7,8).
What are the key properties of 3,5-dimethyl-4-(methylaminomethyl)aniline;1H-pyrazole-4-carboxylic acid?
3,5-dimethyl-4-(methylaminomethyl)aniline;1H-pyrazole-4-carboxylic acid has a molecular weight of 276.34 g/mol, XLogP of 1.71, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-(methylaminomethyl)aniline;1H-pyrazole-4-carboxylic acid is sourced from PubChem (CID 174936436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).