About 1-azido-2-methylbenzene;dichloromethane
1-azido-2-methylbenzene;dichloromethane (PubChem CID 174936833) has the molecular formula C8H9Cl2N3
and a molecular weight of 218.09 g/mol. Its IUPAC name is 1-azido-2-methylbenzene;dichloromethane.
Molecular Properties
| Compound Name | 1-azido-2-methylbenzene;dichloromethane |
| PubChem CID | 174936833 |
| Molecular Formula | C8H9Cl2N3 |
| Molecular Weight | 218.09 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | 1-azido-2-methylbenzene;dichloromethane |
| SMILES | Cc1ccccc1N=[N+]=[N-].ClCCl |
| InChI | InChI=1S/C7H7N3.CH2Cl2/c1-6-4-2-3-5-7(6)9-10-8;2-1-3/h2-5H,1H3;1H2 |
| InChIKey | LYVSJWZRPXVODG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.09 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-azido-2-methylbenzene;dichloromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azido-2-methylbenzene;dichloromethane?
The IUPAC name of 1-azido-2-methylbenzene;dichloromethane (CID 174936833) is 1-azido-2-methylbenzene;dichloromethane.
What is the SMILES notation for 1-azido-2-methylbenzene;dichloromethane?
The canonical SMILES for 1-azido-2-methylbenzene;dichloromethane is Cc1ccccc1N=[N+]=[N-].ClCCl.
What is the InChIKey of 1-azido-2-methylbenzene;dichloromethane?
The InChIKey is LYVSJWZRPXVODG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3.CH2Cl2/c1-6-4-2-3-5-7(6)9-10-8;2-1-3/h2-5H,1H3;1H2.
What are the key properties of 1-azido-2-methylbenzene;dichloromethane?
1-azido-2-methylbenzene;dichloromethane has a molecular weight of 218.09 g/mol, XLogP of 4.36, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azido-2-methylbenzene;dichloromethane is sourced from PubChem (CID 174936833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).