C14H14FNO5 — CID 174937189
(3,3-dimethyl-2-methylidenebutanoyl) 3-fluoro-2-nitrobenzoate (PubChem CID 174937189) has the molecular formula C14H14FNO5 and a molecular weight of 295.27 g/mol. Its IUPAC name is (3,3-dimethyl-2-methylidenebutanoyl) 3-fluoro-2-nitrobenzoate.
| Compound Name | (3,3-dimethyl-2-methylidenebutanoyl) 3-fluoro-2-nitrobenzoate |
|---|---|
| PubChem CID | 174937189 |
| Molecular Formula | C14H14FNO5 |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | (3,3-dimethyl-2-methylidenebutanoyl) 3-fluoro-2-nitrobenzoate |
| SMILES | C=C(C(=O)OC(=O)c1cccc(F)c1[N+](=O)[O-])C(C)(C)C |
| InChI | InChI=1S/C14H14FNO5/c1-8(14(2,3)4)12(17)21-13(18)9-6-5-7-10(15)11(9)16(19)20/h5-7H,1H2,2-4H3 |
| InChIKey | YQYUJUGBGFWJGC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|